C9H12Cl2 — CID 123372962
2,3-dichloro-5-methylocta-1,3,5-triene (PubChem CID 123372962) has the molecular formula C9H12Cl2 and a molecular weight of 191.10 g/mol. Its IUPAC name is 2,3-dichloro-5-methylocta-1,3,5-triene.
| Compound Name | 2,3-dichloro-5-methylocta-1,3,5-triene |
|---|---|
| PubChem CID | 123372962 |
| Molecular Formula | C9H12Cl2 |
| Molecular Weight | 191.10 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 2,3-dichloro-5-methylocta-1,3,5-triene |
| SMILES | C=C(Cl)C(Cl)=CC(C)=CCC |
| InChI | InChI=1S/C9H12Cl2/c1-4-5-7(2)6-9(11)8(3)10/h5-6H,3-4H2,1-2H3 |
| InChIKey | SOAMPWLTIRJXBU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.10 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|