About methylcarbamoyloxymethyl N-methylcarbamate;methylimino(oxo)methane
methylcarbamoyloxymethyl N-methylcarbamate;methylimino(oxo)methane (PubChem CID 162238586) has the molecular formula C9H16N4O6
and a molecular weight of 276.25 g/mol. Its IUPAC name is methylcarbamoyloxymethyl N-methylcarbamate;methylimino(oxo)methane.
Molecular Properties
| Compound Name | methylcarbamoyloxymethyl N-methylcarbamate;methylimino(oxo)methane |
| PubChem CID | 162238586 |
| Molecular Formula | C9H16N4O6 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | methylcarbamoyloxymethyl N-methylcarbamate;methylimino(oxo)methane |
| SMILES | CN=C=O.CN=C=O.CNC(=O)OCOC(=O)NC |
| InChI | InChI=1S/C5H10N2O4.2C2H3NO/c1-6-4(8)10-3-11-5(9)7-2;2*1-3-2-4/h3H2,1-2H3,(H,6,8)(H,7,9);2*1H3 |
| InChIKey | ZWJYJBRYFQLDBK-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze methylcarbamoyloxymethyl N-methylcarbamate;methylimino(oxo)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylcarbamoyloxymethyl N-methylcarbamate;methylimino(oxo)methane?
The IUPAC name of methylcarbamoyloxymethyl N-methylcarbamate;methylimino(oxo)methane (CID 162238586) is methylcarbamoyloxymethyl N-methylcarbamate;methylimino(oxo)methane.
What is the SMILES notation for methylcarbamoyloxymethyl N-methylcarbamate;methylimino(oxo)methane?
The canonical SMILES for methylcarbamoyloxymethyl N-methylcarbamate;methylimino(oxo)methane is CN=C=O.CN=C=O.CNC(=O)OCOC(=O)NC.
What is the InChIKey of methylcarbamoyloxymethyl N-methylcarbamate;methylimino(oxo)methane?
The InChIKey is ZWJYJBRYFQLDBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O4.2C2H3NO/c1-6-4(8)10-3-11-5(9)7-2;2*1-3-2-4/h3H2,1-2H3,(H,6,8)(H,7,9);2*1H3.
What are the key properties of methylcarbamoyloxymethyl N-methylcarbamate;methylimino(oxo)methane?
methylcarbamoyloxymethyl N-methylcarbamate;methylimino(oxo)methane has a molecular weight of 276.25 g/mol, XLogP of -0.44, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methylcarbamoyloxymethyl N-methylcarbamate;methylimino(oxo)methane is sourced from PubChem (CID 162238586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).