C12H28Cl2N6 — CID 19917315
N,N',2-trimethyl-2-[[2-methyl-1-(methylamino)-1-methyliminopropan-2-yl]diazenyl]propanimidamide;dihydrochloride (PubChem CID 19917315) has the molecular formula C12H28Cl2N6 and a molecular weight of 327.30 g/mol. Its IUPAC name is N,N',2-trimethyl-2-[[2-methyl-1-(methylamino)-1-methyliminopropan-2-yl]diazenyl]propanimidamide;dihydrochloride.
| Compound Name | N,N',2-trimethyl-2-[[2-methyl-1-(methylamino)-1-methyliminopropan-2-yl]diazenyl]propanimidamide;dihydrochloride |
|---|---|
| PubChem CID | 19917315 |
| Molecular Formula | C12H28Cl2N6 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | N,N',2-trimethyl-2-[[2-methyl-1-(methylamino)-1-methyliminopropan-2-yl]diazenyl]propanimidamide;dihydrochloride |
| SMILES | C/N=C(\NC)C(C)(C)/N=N/C(C)(C)/C(=N/C)NC.Cl.Cl |
| InChI | InChI=1S/C12H26N6.2ClH/c1-11(2,9(13-5)14-6)17-18-12(3,4)10(15-7)16-8;;/h1-8H3,(H,13,14)(H,15,16);2*1H/b18-17+;; |
| InChIKey | YQRYDMKHTCFRPT-QIKYXUGXSA-N |
| XLogP | 2.33 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|