C14H28N2 — CID 143256854
N-[(3Z)-3,5-dimethylhexa-1,3,5-trien-2-yl]-N'-methylmethanimidamide;ethane (PubChem CID 143256854) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is N-[(3Z)-3,5-dimethylhexa-1,3,5-trien-2-yl]-N'-methylmethanimidamide;ethane.
| Compound Name | N-[(3Z)-3,5-dimethylhexa-1,3,5-trien-2-yl]-N'-methylmethanimidamide;ethane |
|---|---|
| PubChem CID | 143256854 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | N-[(3Z)-3,5-dimethylhexa-1,3,5-trien-2-yl]-N'-methylmethanimidamide;ethane |
| SMILES | C=C(C)/C=C(/C)C(=C)N/C=N/C.CC.CC |
| InChI | InChI=1S/C10H16N2.2C2H6/c1-8(2)6-9(3)10(4)12-7-11-5;2*1-2/h6-7H,1,4H2,2-3,5H3,(H,11,12);2*1-2H3/b9-6-;; |
| InChIKey | POIWBQVFEDPTIA-MPTFJDTDSA-N |
| XLogP | 4.32 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|