C18H26N2 — CID 91311689
10-[(3Z)-7-methylidenenona-1,3-dien-2-yl]-1,4,5,6-tetrahydro-1,3-diazecine (PubChem CID 91311689) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 10-[(3Z)-7-methylidenenona-1,3-dien-2-yl]-1,4,5,6-tetrahydro-1,3-diazecine.
| Compound Name | 10-[(3Z)-7-methylidenenona-1,3-dien-2-yl]-1,4,5,6-tetrahydro-1,3-diazecine |
|---|---|
| PubChem CID | 91311689 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 10-[(3Z)-7-methylidenenona-1,3-dien-2-yl]-1,4,5,6-tetrahydro-1,3-diazecine |
| SMILES | C=C(CC)CC/C=C\C(=C)C1=CC=CCCC/N=C\N1 |
| InChI | InChI=1S/C18H26N2/c1-4-16(2)11-8-9-12-17(3)18-13-7-5-6-10-14-19-15-20-18/h5,7,9,12-13,15H,2-4,6,8,10-11,14H2,1H3,(H,19,20)/b7-5?,12-9-,18-13? |
| InChIKey | QIFFFPOWFHKFOS-KGXBEXRVSA-N |
| XLogP | 4.70 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|