C9H14N2 — CID 123441819
N'-methyl-N-(3-methylidenehexa-1,4-dien-2-yl)methanimidamide (PubChem CID 123441819) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is N'-methyl-N-(3-methylidenehexa-1,4-dien-2-yl)methanimidamide.
| Compound Name | N'-methyl-N-(3-methylidenehexa-1,4-dien-2-yl)methanimidamide |
|---|---|
| PubChem CID | 123441819 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | N'-methyl-N-(3-methylidenehexa-1,4-dien-2-yl)methanimidamide |
| SMILES | C=C(C=CC)C(=C)N/C=N/C |
| InChI | InChI=1S/C9H14N2/c1-5-6-8(2)9(3)11-7-10-4/h5-7H,2-3H2,1,4H3,(H,10,11) |
| InChIKey | GSSVHYSYBNIOFR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|