C9H10N2 — CID 91065909
8-methyl-3,7-dihydrocyclohepta[d]imidazole (PubChem CID 91065909) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 8-methyl-3,7-dihydrocyclohepta[d]imidazole.
| Compound Name | 8-methyl-3,7-dihydrocyclohepta[d]imidazole |
|---|---|
| PubChem CID | 91065909 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 8-methyl-3,7-dihydrocyclohepta[d]imidazole |
| SMILES | CC1=c2nc[nH]c2=CC=CC1 |
| InChI | InChI=1S/C9H10N2/c1-7-4-2-3-5-8-9(7)11-6-10-8/h2-3,5-6H,4H2,1H3,(H,10,11) |
| InChIKey | LKBMMJIFOBZFOU-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |