About [5-(trifluoromethyl)-3,7-dihydrocyclohepta[d]imidazol-8-yl]methanamine
[5-(trifluoromethyl)-3,7-dihydrocyclohepta[d]imidazol-8-yl]methanamine (PubChem CID 142937788) has the molecular formula C10H10F3N3
and a molecular weight of 229.20 g/mol. Its IUPAC name is [5-(trifluoromethyl)-3,7-dihydrocyclohepta[d]imidazol-8-yl]methanamine.
Molecular Properties
| Compound Name | [5-(trifluoromethyl)-3,7-dihydrocyclohepta[d]imidazol-8-yl]methanamine |
| PubChem CID | 142937788 |
| Molecular Formula | C10H10F3N3 |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | [5-(trifluoromethyl)-3,7-dihydrocyclohepta[d]imidazol-8-yl]methanamine |
| SMILES | NCC1=c2nc[nH]c2=CC(C(F)(F)F)=CC1 |
| InChI | InChI=1S/C10H10F3N3/c11-10(12,13)7-2-1-6(4-14)9-8(3-7)15-5-16-9/h2-3,5H,1,4,14H2,(H,15,16) |
| InChIKey | GRYAJOMNBYSPBJ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [5-(trifluoromethyl)-3,7-dihydrocyclohepta[d]imidazol-8-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(trifluoromethyl)-3,7-dihydrocyclohepta[d]imidazol-8-yl]methanamine?
The IUPAC name of [5-(trifluoromethyl)-3,7-dihydrocyclohepta[d]imidazol-8-yl]methanamine (CID 142937788) is [5-(trifluoromethyl)-3,7-dihydrocyclohepta[d]imidazol-8-yl]methanamine.
What is the SMILES notation for [5-(trifluoromethyl)-3,7-dihydrocyclohepta[d]imidazol-8-yl]methanamine?
The canonical SMILES for [5-(trifluoromethyl)-3,7-dihydrocyclohepta[d]imidazol-8-yl]methanamine is NCC1=c2nc[nH]c2=CC(C(F)(F)F)=CC1.
What is the InChIKey of [5-(trifluoromethyl)-3,7-dihydrocyclohepta[d]imidazol-8-yl]methanamine?
The InChIKey is GRYAJOMNBYSPBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3N3/c11-10(12,13)7-2-1-6(4-14)9-8(3-7)15-5-16-9/h2-3,5H,1,4,14H2,(H,15,16).
What are the key properties of [5-(trifluoromethyl)-3,7-dihydrocyclohepta[d]imidazol-8-yl]methanamine?
[5-(trifluoromethyl)-3,7-dihydrocyclohepta[d]imidazol-8-yl]methanamine has a molecular weight of 229.20 g/mol, XLogP of 0.19, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(trifluoromethyl)-3,7-dihydrocyclohepta[d]imidazol-8-yl]methanamine is sourced from PubChem (CID 142937788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).