C12H22N2 — CID 123443972
N-[(E)-hex-3-en-3-yl]-N'-(2-methylidenebutyl)methanimidamide (PubChem CID 123443972) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is N-[(E)-hex-3-en-3-yl]-N'-(2-methylidenebutyl)methanimidamide.
| Compound Name | N-[(E)-hex-3-en-3-yl]-N'-(2-methylidenebutyl)methanimidamide |
|---|---|
| PubChem CID | 123443972 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N-[(E)-hex-3-en-3-yl]-N'-(2-methylidenebutyl)methanimidamide |
| SMILES | C=C(CC)C/N=C/N/C(=C/CC)CC |
| InChI | InChI=1S/C12H22N2/c1-5-8-12(7-3)14-10-13-9-11(4)6-2/h8,10H,4-7,9H2,1-3H3,(H,13,14)/b12-8+ |
| InChIKey | DHQSJVGDHGTFES-XYOKQWHBSA-N |
| XLogP | 3.27 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|