C6H11N3 — CID 123387802
6-ethyl-1,4-dihydropyrimidin-4-amine (PubChem CID 123387802) has the molecular formula C6H11N3 and a molecular weight of 125.17 g/mol. Its IUPAC name is 6-ethyl-1,4-dihydropyrimidin-4-amine.
| Compound Name | 6-ethyl-1,4-dihydropyrimidin-4-amine |
|---|---|
| PubChem CID | 123387802 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 6-ethyl-1,4-dihydropyrimidin-4-amine |
| SMILES | CCC1=CC(N)N=CN1 |
| InChI | InChI=1S/C6H11N3/c1-2-5-3-6(7)9-4-8-5/h3-4,6H,2,7H2,1H3,(H,8,9) |
| InChIKey | VENYKMJNYYGXOA-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |