C8H13N3 — CID 143088471
1-cyclohexa-1,5-dien-1-yl-2-methylguanidine (PubChem CID 143088471) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-2-methylguanidine.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-2-methylguanidine |
|---|---|
| PubChem CID | 143088471 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-2-methylguanidine |
| SMILES | C/N=C(\N)NC1=CCCC=C1 |
| InChI | InChI=1S/C8H13N3/c1-10-8(9)11-7-5-3-2-4-6-7/h3,5-6H,2,4H2,1H3,(H3,9,10,11) |
| InChIKey | YYGQQGMBUSYVNW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|