C18H33N3 — CID 145203944
ethane;2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-[(3E)-hexa-3,5-dien-3-yl]guanidine (PubChem CID 145203944) has the molecular formula C18H33N3 and a molecular weight of 291.48 g/mol. Its IUPAC name is ethane;2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-[(3E)-hexa-3,5-dien-3-yl]guanidine.
| Compound Name | ethane;2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-[(3E)-hexa-3,5-dien-3-yl]guanidine |
|---|---|
| PubChem CID | 145203944 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | ethane;2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-[(3E)-hexa-3,5-dien-3-yl]guanidine |
| SMILES | C=C/C=C\C(=C/C)\N=C(/N)N/C(=C/C=C)CC.CC.CC |
| InChI | InChI=1S/C14H21N3.2C2H6/c1-5-9-11-13(8-4)17-14(15)16-12(7-3)10-6-2;2*1-2/h5-6,8-11H,1-2,7H2,3-4H3,(H3,15,16,17);2*1-2H3/b11-9-,12-10+,13-8+;; |
| InChIKey | GVWSOWWHIBPRIE-NYBGGQDXSA-N |
| XLogP | 5.07 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|