C20H38N4 — CID 142393969
N-[amino-(3-methylbut-1-en-2-ylamino)methylidene]-N'-[(3E)-hexa-1,3,5-trien-3-yl]ethanimidamide;butane;ethane (PubChem CID 142393969) has the molecular formula C20H38N4 and a molecular weight of 334.55 g/mol. Its IUPAC name is N-[amino-(3-methylbut-1-en-2-ylamino)methylidene]-N'-[(3E)-hexa-1,3,5-trien-3-yl]ethanimidamide;butane;ethane.
| Compound Name | N-[amino-(3-methylbut-1-en-2-ylamino)methylidene]-N'-[(3E)-hexa-1,3,5-trien-3-yl]ethanimidamide;butane;ethane |
|---|---|
| PubChem CID | 142393969 |
| Molecular Formula | C20H38N4 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.31 |
| IUPAC Name | N-[amino-(3-methylbut-1-en-2-ylamino)methylidene]-N'-[(3E)-hexa-1,3,5-trien-3-yl]ethanimidamide;butane;ethane |
| SMILES | C=C/C=C(C=C)/N=C(C)/N=C(\N)NC(=C)C(C)C.CC.CCCC |
| InChI | InChI=1S/C14H22N4.C4H10.C2H6/c1-7-9-13(8-2)17-12(6)18-14(15)16-11(5)10(3)4;1-3-4-2;1-2/h7-10H,1-2,5H2,3-4,6H3,(H3,15,16,17,18);3-4H2,1-2H3;1-2H3/b13-9+;; |
| InChIKey | WBAKVNKWDHDOMR-IGUOPLJTSA-N |
| XLogP | 5.57 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|