C17H25N7 — CID 22086201
2,4,6,8,10,16-hexamethyl-12,14-dimethylidene-1,3,5,7,9,11,13-heptazacyclohexadeca-2,4,6,8,10,15-hexaene (PubChem CID 22086201) has the molecular formula C17H25N7 and a molecular weight of 327.44 g/mol. Its IUPAC name is 2,4,6,8,10,16-hexamethyl-12,14-dimethylidene-1,3,5,7,9,11,13-heptazacyclohexadeca-2,4,6,8,10,15-hexaene.
| Compound Name | 2,4,6,8,10,16-hexamethyl-12,14-dimethylidene-1,3,5,7,9,11,13-heptazacyclohexadeca-2,4,6,8,10,15-hexaene |
|---|---|
| PubChem CID | 22086201 |
| Molecular Formula | C17H25N7 |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 2,4,6,8,10,16-hexamethyl-12,14-dimethylidene-1,3,5,7,9,11,13-heptazacyclohexadeca-2,4,6,8,10,15-hexaene |
| SMILES | C=c1cc(C)[nH]c(C)nc(C)nc(C)nc(C)nc(C)nc(=C)[nH]1 |
| InChI | InChI=1S/C17H25N7/c1-10-9-11(2)19-13(4)21-15(6)23-17(8)24-16(7)22-14(5)20-12(3)18-10/h9,18H,1,3H2,2,4-8H3,(H,19,20,21,22,23,24)/b11-9+ |
| InChIKey | XTKKENJEQHWFEM-PKNBQFBNSA-N |
| XLogP | 1.36 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |