About N-[(Z)-but-2-en-2-yl]-N'-but-2-en-2-ylethanimidamide
N-[(Z)-but-2-en-2-yl]-N'-but-2-en-2-ylethanimidamide (PubChem CID 123655703) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is N-[(Z)-but-2-en-2-yl]-N'-but-2-en-2-ylethanimidamide.
Molecular Properties
| Compound Name | N-[(Z)-but-2-en-2-yl]-N'-but-2-en-2-ylethanimidamide |
| PubChem CID | 123655703 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N-[(Z)-but-2-en-2-yl]-N'-but-2-en-2-ylethanimidamide |
| SMILES | CC=C(C)/N=C(\C)N/C(C)=C\C |
| InChI | InChI=1S/C10H18N2/c1-6-8(3)11-10(5)12-9(4)7-2/h6-7H,1-5H3,(H,11,12)/b8-6-,9-7? |
| InChIKey | OAQXAFOAJCEGJQ-VFUVOHNVSA-N |
| XLogP | 2.84 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-but-2-en-2-yl]-N'-but-2-en-2-ylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-but-2-en-2-yl]-N'-but-2-en-2-ylethanimidamide?
The IUPAC name of N-[(Z)-but-2-en-2-yl]-N'-but-2-en-2-ylethanimidamide (CID 123655703) is N-[(Z)-but-2-en-2-yl]-N'-but-2-en-2-ylethanimidamide.
What is the SMILES notation for N-[(Z)-but-2-en-2-yl]-N'-but-2-en-2-ylethanimidamide?
The canonical SMILES for N-[(Z)-but-2-en-2-yl]-N'-but-2-en-2-ylethanimidamide is CC=C(C)/N=C(\C)N/C(C)=C\C.
What is the InChIKey of N-[(Z)-but-2-en-2-yl]-N'-but-2-en-2-ylethanimidamide?
The InChIKey is OAQXAFOAJCEGJQ-VFUVOHNVSA-N. The full InChI is InChI=1S/C10H18N2/c1-6-8(3)11-10(5)12-9(4)7-2/h6-7H,1-5H3,(H,11,12)/b8-6-,9-7?.
What are the key properties of N-[(Z)-but-2-en-2-yl]-N'-but-2-en-2-ylethanimidamide?
N-[(Z)-but-2-en-2-yl]-N'-but-2-en-2-ylethanimidamide has a molecular weight of 166.27 g/mol, XLogP of 2.84, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-but-2-en-2-yl]-N'-but-2-en-2-ylethanimidamide is sourced from PubChem (CID 123655703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).