About N-(N-but-2-en-2-yl-N'-methylcarbamimidoyl)-N'-ethylethanimidamide
N-(N-but-2-en-2-yl-N'-methylcarbamimidoyl)-N'-ethylethanimidamide (PubChem CID 123321964) has the molecular formula C10H20N4
and a molecular weight of 196.30 g/mol. Its IUPAC name is N-(N-but-2-en-2-yl-N'-methylcarbamimidoyl)-N'-ethylethanimidamide.
Molecular Properties
| Compound Name | N-(N-but-2-en-2-yl-N'-methylcarbamimidoyl)-N'-ethylethanimidamide |
| PubChem CID | 123321964 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | N-(N-but-2-en-2-yl-N'-methylcarbamimidoyl)-N'-ethylethanimidamide |
| SMILES | CC=C(C)N/C(=N\C)N/C(C)=N/CC |
| InChI | InChI=1S/C10H20N4/c1-6-8(3)13-10(11-5)14-9(4)12-7-2/h6H,7H2,1-5H3,(H2,11,12,13,14) |
| InChIKey | MBKGMIKTKVCOCY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(N-but-2-en-2-yl-N'-methylcarbamimidoyl)-N'-ethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(N-but-2-en-2-yl-N'-methylcarbamimidoyl)-N'-ethylethanimidamide?
The IUPAC name of N-(N-but-2-en-2-yl-N'-methylcarbamimidoyl)-N'-ethylethanimidamide (CID 123321964) is N-(N-but-2-en-2-yl-N'-methylcarbamimidoyl)-N'-ethylethanimidamide.
What is the SMILES notation for N-(N-but-2-en-2-yl-N'-methylcarbamimidoyl)-N'-ethylethanimidamide?
The canonical SMILES for N-(N-but-2-en-2-yl-N'-methylcarbamimidoyl)-N'-ethylethanimidamide is CC=C(C)N/C(=N\C)N/C(C)=N/CC.
What is the InChIKey of N-(N-but-2-en-2-yl-N'-methylcarbamimidoyl)-N'-ethylethanimidamide?
The InChIKey is MBKGMIKTKVCOCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4/c1-6-8(3)13-10(11-5)14-9(4)12-7-2/h6H,7H2,1-5H3,(H2,11,12,13,14).
What are the key properties of N-(N-but-2-en-2-yl-N'-methylcarbamimidoyl)-N'-ethylethanimidamide?
N-(N-but-2-en-2-yl-N'-methylcarbamimidoyl)-N'-ethylethanimidamide has a molecular weight of 196.30 g/mol, XLogP of 1.51, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(N-but-2-en-2-yl-N'-methylcarbamimidoyl)-N'-ethylethanimidamide is sourced from PubChem (CID 123321964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).