C17H24N4 — CID 123344635
N'-[1-(but-3-en-2-ylideneamino)ethenyl]-N-[(3E)-4-(but-3-en-2-ylideneamino)penta-1,3-dien-2-yl]ethanimidamide (PubChem CID 123344635) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is N'-[1-(but-3-en-2-ylideneamino)ethenyl]-N-[(3E)-4-(but-3-en-2-ylideneamino)penta-1,3-dien-2-yl]ethanimidamide.
| Compound Name | N'-[1-(but-3-en-2-ylideneamino)ethenyl]-N-[(3E)-4-(but-3-en-2-ylideneamino)penta-1,3-dien-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 123344635 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | N'-[1-(but-3-en-2-ylideneamino)ethenyl]-N-[(3E)-4-(but-3-en-2-ylideneamino)penta-1,3-dien-2-yl]ethanimidamide |
| SMILES | C=CC(C)=NC(=C)N=C(C)NC(=C)/C=C(C)/N=C(\C)C=C |
| InChI | InChI=1S/C17H24N4/c1-9-12(3)18-14(5)11-15(6)20-17(8)21-16(7)19-13(4)10-2/h9-11H,1-2,6-7H2,3-5,8H3,(H,20,21)/b14-11+,18-12+,19-13? |
| InChIKey | BEYCRJIYKDBUFL-HZXPPLBQSA-N |
| XLogP | 4.18 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|