C12H18N2 — CID 143658325
N'-methyl-N-[(3Z)-nona-1,3,6,8-tetraen-2-yl]ethanimidamide (PubChem CID 143658325) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is N'-methyl-N-[(3Z)-nona-1,3,6,8-tetraen-2-yl]ethanimidamide.
| Compound Name | N'-methyl-N-[(3Z)-nona-1,3,6,8-tetraen-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 143658325 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | N'-methyl-N-[(3Z)-nona-1,3,6,8-tetraen-2-yl]ethanimidamide |
| SMILES | C=CC=CC/C=C\C(=C)N/C(C)=N/C |
| InChI | InChI=1S/C12H18N2/c1-5-6-7-8-9-10-11(2)14-12(3)13-4/h5-7,9-10H,1-2,8H2,3-4H3,(H,13,14)/b7-6?,10-9- |
| InChIKey | XTAJPMLWEJZFPW-CZTAHCJSSA-N |
| XLogP | 2.83 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|