C16H29N3 — CID 159102531
N'-buta-1,3-dien-2-yl-N-[(3Z)-penta-1,3-dien-2-yl]ethanimidamide;N,N-dimethylpropan-1-amine (PubChem CID 159102531) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is N'-buta-1,3-dien-2-yl-N-[(3Z)-penta-1,3-dien-2-yl]ethanimidamide;N,N-dimethylpropan-1-amine.
| Compound Name | N'-buta-1,3-dien-2-yl-N-[(3Z)-penta-1,3-dien-2-yl]ethanimidamide;N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 159102531 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | N'-buta-1,3-dien-2-yl-N-[(3Z)-penta-1,3-dien-2-yl]ethanimidamide;N,N-dimethylpropan-1-amine |
| SMILES | C=CC(=C)/N=C(\C)NC(=C)/C=C\C.CCCN(C)C |
| InChI | InChI=1S/C11H16N2.C5H13N/c1-6-8-10(4)13-11(5)12-9(3)7-2;1-4-5-6(2)3/h6-8H,2-4H2,1,5H3,(H,12,13);4-5H2,1-3H3/b8-6-; |
| InChIKey | KDLSEASCRSRJCY-PHZXCRFESA-N |
| XLogP | 3.74 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|