C8H15N — CID 126549325
(3E)-N-propan-2-ylpenta-1,3-dien-2-amine (PubChem CID 126549325) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is (3E)-N-propan-2-ylpenta-1,3-dien-2-amine.
| Compound Name | (3E)-N-propan-2-ylpenta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 126549325 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (3E)-N-propan-2-ylpenta-1,3-dien-2-amine |
| SMILES | C=C(/C=C/C)NC(C)C |
| InChI | InChI=1S/C8H15N/c1-5-6-8(4)9-7(2)3/h5-7,9H,4H2,1-3H3/b6-5+ |
| InChIKey | LZKPGMJKTSTGKD-AATRIKPKSA-N |
| XLogP | 2.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|