C13H16N2 — CID 123975051
N-penta-1,3-dien-2-yl-N'-phenylethanimidamide (PubChem CID 123975051) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is N-penta-1,3-dien-2-yl-N'-phenylethanimidamide.
| Compound Name | N-penta-1,3-dien-2-yl-N'-phenylethanimidamide |
|---|---|
| PubChem CID | 123975051 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | N-penta-1,3-dien-2-yl-N'-phenylethanimidamide |
| SMILES | C=C(C=CC)N/C(C)=N/c1ccccc1 |
| InChI | InChI=1S/C13H16N2/c1-4-8-11(2)14-12(3)15-13-9-6-5-7-10-13/h4-10H,2H2,1,3H3,(H,14,15) |
| InChIKey | IKEFUHMLMSFTDM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|