C16H15N — CID 5382915
(E)-N,4-diphenylbut-3-en-2-imine (PubChem CID 5382915) has the molecular formula C16H15N and a molecular weight of 221.30 g/mol. Its IUPAC name is (E)-N,4-diphenylbut-3-en-2-imine.
| Compound Name | (E)-N,4-diphenylbut-3-en-2-imine |
|---|---|
| PubChem CID | 5382915 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (E)-N,4-diphenylbut-3-en-2-imine |
| SMILES | CC(/C=C/c1ccccc1)=N\c1ccccc1 |
| InChI | InChI=1S/C16H15N/c1-14(17-16-10-6-3-7-11-16)12-13-15-8-4-2-5-9-15/h2-13H,1H3/b13-12+,17-14+ |
| InChIKey | SWZIFMPZYZSWMD-MIFVOYFBSA-N |
| XLogP | 4.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|