C14H27N — CID 178019036
ethane;(3E,5Z)-N-ethyl-N-propylhepta-1,3,5-trien-4-amine (PubChem CID 178019036) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is ethane;(3E,5Z)-N-ethyl-N-propylhepta-1,3,5-trien-4-amine.
| Compound Name | ethane;(3E,5Z)-N-ethyl-N-propylhepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 178019036 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | ethane;(3E,5Z)-N-ethyl-N-propylhepta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(\C=C/C)N(CC)CCC.CC |
| InChI | InChI=1S/C12H21N.C2H6/c1-5-9-12(10-6-2)13(8-4)11-7-3;1-2/h5-6,9-10H,1,7-8,11H2,2-4H3;1-2H3/b10-6-,12-9+; |
| InChIKey | YSMJHBKTYAMEGD-UZHTWQFDSA-N |
| XLogP | 4.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|