C20H27N — CID 139420267
(3E,5Z)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]hepta-1,3,5-trien-4-amine (PubChem CID 139420267) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is (3E,5Z)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]hepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5Z)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]hepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 139420267 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | (3E,5Z)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]hepta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(\C=C/C)N(C(/C=C\C)=C/C)C(/C=C\C)=C/C=C |
| InChI | InChI=1S/C20H27N/c1-7-13-18(12-6)21(19(14-8-2)15-9-3)20(16-10-4)17-11-5/h7-17H,2,4H2,1,3,5-6H3/b13-7-,15-9-,17-11-,18-12+,19-14+,20-16+ |
| InChIKey | HUJYSHXGODMRGS-SHMVDTNOSA-N |
| XLogP | 6.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|