C31H37N — CID 146531240
(3E,5E,7E,9Z)-6,7-bis(ethenyl)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]undeca-1,3,5,7,9-pentaen-3-amine (PubChem CID 146531240) has the molecular formula C31H37N and a molecular weight of 423.64 g/mol. Its IUPAC name is (3E,5E,7E,9Z)-6,7-bis(ethenyl)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]undeca-1,3,5,7,9-pentaen-3-amine.
| Compound Name | (3E,5E,7E,9Z)-6,7-bis(ethenyl)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]undeca-1,3,5,7,9-pentaen-3-amine |
|---|---|
| PubChem CID | 146531240 |
| Molecular Formula | C31H37N |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | (3E,5E,7E,9Z)-6,7-bis(ethenyl)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]undeca-1,3,5,7,9-pentaen-3-amine |
| SMILES | C=C/C=C\C(=C/C=C)N(/C(C=C)=C/C=C(C=C)/C(C=C)=C/C=C\C)C(/C=C\C)=C/C=C\C |
| InChI | InChI=1S/C31H37N/c1-9-17-22-27(14-6)28(15-7)25-26-29(16-8)32(30(20-12-4)23-18-10-2)31(21-13-5)24-19-11-3/h9-26H,2,4,6-8H2,1,3,5H3/b17-9-,19-11-,21-13-,23-18-,27-22+,28-25+,29-26+,30-20+,31-24+ |
| InChIKey | ODPXLNLJLCGIHU-OALWIOTJSA-N |
| XLogP | 9.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|