C16H27N — CID 143203776
ethane;(3E,5Z)-N-ethyl-N-[(3E)-penta-1,3-dien-3-yl]hepta-1,3,5-trien-4-amine (PubChem CID 143203776) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is ethane;(3E,5Z)-N-ethyl-N-[(3E)-penta-1,3-dien-3-yl]hepta-1,3,5-trien-4-amine.
| Compound Name | ethane;(3E,5Z)-N-ethyl-N-[(3E)-penta-1,3-dien-3-yl]hepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 143203776 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | ethane;(3E,5Z)-N-ethyl-N-[(3E)-penta-1,3-dien-3-yl]hepta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(\C=C/C)N(CC)/C(C=C)=C/C.CC |
| InChI | InChI=1S/C14H21N.C2H6/c1-6-11-14(12-7-2)15(10-5)13(8-3)9-4;1-2/h6-9,11-12H,1,3,10H2,2,4-5H3;1-2H3/b12-7-,13-9+,14-11+; |
| InChIKey | KKMIZHGOTBVKNQ-HJSGMMIPSA-N |
| XLogP | 5.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|