C10H20N2 — CID 142087922
ethane;(3Z)-N-methyl-2-methyliminohexa-3,5-dien-1-amine (PubChem CID 142087922) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is ethane;(3Z)-N-methyl-2-methyliminohexa-3,5-dien-1-amine.
| Compound Name | ethane;(3Z)-N-methyl-2-methyliminohexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 142087922 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | ethane;(3Z)-N-methyl-2-methyliminohexa-3,5-dien-1-amine |
| SMILES | C=C/C=C\C(CNC)=N\C.CC |
| InChI | InChI=1S/C8H14N2.C2H6/c1-4-5-6-8(10-3)7-9-2;1-2/h4-6,9H,1,7H2,2-3H3;1-2H3/b6-5-,10-8-; |
| InChIKey | YJEPJHQVCKGKHJ-WXKPPQSVSA-N |
| XLogP | 2.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|