C6H12N4O2 — CID 163949914
N'-methyl-3-methylimino-1-nitrobut-1-ene-1,4-diamine (PubChem CID 163949914) has the molecular formula C6H12N4O2 and a molecular weight of 172.19 g/mol. Its IUPAC name is N'-methyl-3-methylimino-1-nitrobut-1-ene-1,4-diamine.
| Compound Name | N'-methyl-3-methylimino-1-nitrobut-1-ene-1,4-diamine |
|---|---|
| PubChem CID | 163949914 |
| Molecular Formula | C6H12N4O2 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | N'-methyl-3-methylimino-1-nitrobut-1-ene-1,4-diamine |
| SMILES | C/N=C(/C=C(N)[N+](=O)[O-])CNC |
| InChI | InChI=1S/C6H12N4O2/c1-8-4-5(9-2)3-6(7)10(11)12/h3,8H,4,7H2,1-2H3/b6-3?,9-5- |
| InChIKey | SZXJDMMPCGFJDG-SKNZTSOSSA-N |
| XLogP | -0.65 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|