About 2-methyl-1,1-dinitroguanidine
2-methyl-1,1-dinitroguanidine (PubChem CID 21424116) has the molecular formula C2H5N5O4
and a molecular weight of 163.09 g/mol. Its IUPAC name is 2-methyl-1,1-dinitroguanidine.
Molecular Properties
| Compound Name | 2-methyl-1,1-dinitroguanidine |
| PubChem CID | 21424116 |
| Molecular Formula | C2H5N5O4 |
| Molecular Weight | 163.09 g/mol |
| Exact Mass | 163.03 |
| IUPAC Name | 2-methyl-1,1-dinitroguanidine |
| SMILES | C/N=C(\N)N([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C2H5N5O4/c1-4-2(3)5(6(8)9)7(10)11/h1H3,(H2,3,4) |
| InChIKey | MJPCOTCPKZTNHX-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 127.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.09 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,1-dinitroguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,1-dinitroguanidine?
The IUPAC name of 2-methyl-1,1-dinitroguanidine (CID 21424116) is 2-methyl-1,1-dinitroguanidine.
What is the SMILES notation for 2-methyl-1,1-dinitroguanidine?
The canonical SMILES for 2-methyl-1,1-dinitroguanidine is C/N=C(\N)N([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 2-methyl-1,1-dinitroguanidine?
The InChIKey is MJPCOTCPKZTNHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N5O4/c1-4-2(3)5(6(8)9)7(10)11/h1H3,(H2,3,4).
What are the key properties of 2-methyl-1,1-dinitroguanidine?
2-methyl-1,1-dinitroguanidine has a molecular weight of 163.09 g/mol, XLogP of -1.38, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,1-dinitroguanidine is sourced from PubChem (CID 21424116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).