About N'-nitroethanimidamide
N'-nitroethanimidamide (PubChem CID 90887679) has the molecular formula C2H5N3O2
and a molecular weight of 103.08 g/mol. Its IUPAC name is N'-nitroethanimidamide.
Molecular Properties
| Compound Name | N'-nitroethanimidamide |
| PubChem CID | 90887679 |
| Molecular Formula | C2H5N3O2 |
| Molecular Weight | 103.08 g/mol |
| Exact Mass | 103.04 |
| IUPAC Name | N'-nitroethanimidamide |
| SMILES | C/C(N)=N/[N+](=O)[O-] |
| InChI | InChI=1S/C2H5N3O2/c1-2(3)4-5(6)7/h1H3,(H2,3,4) |
| InChIKey | XQKJJLYTBRSECD-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 81.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.08 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-nitroethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-nitroethanimidamide?
The IUPAC name of N'-nitroethanimidamide (CID 90887679) is N'-nitroethanimidamide.
What is the SMILES notation for N'-nitroethanimidamide?
The canonical SMILES for N'-nitroethanimidamide is C/C(N)=N/[N+](=O)[O-].
What is the InChIKey of N'-nitroethanimidamide?
The InChIKey is XQKJJLYTBRSECD-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N3O2/c1-2(3)4-5(6)7/h1H3,(H2,3,4).
What are the key properties of N'-nitroethanimidamide?
N'-nitroethanimidamide has a molecular weight of 103.08 g/mol, XLogP of -0.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-nitroethanimidamide is sourced from PubChem (CID 90887679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).