About methyl N-methyl-N'-nitrocarbamimidate
methyl N-methyl-N'-nitrocarbamimidate (PubChem CID 135581711) has the molecular formula C3H7N3O3
and a molecular weight of 133.11 g/mol. Its IUPAC name is methyl N-methyl-N'-nitrocarbamimidate.
Molecular Properties
| Compound Name | methyl N-methyl-N'-nitrocarbamimidate |
| PubChem CID | 135581711 |
| Molecular Formula | C3H7N3O3 |
| Molecular Weight | 133.11 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | methyl N-methyl-N'-nitrocarbamimidate |
| SMILES | CN/C(=N\[N+](=O)[O-])OC |
| InChI | InChI=1S/C3H7N3O3/c1-4-3(9-2)5-6(7)8/h1-2H3,(H,4,5) |
| InChIKey | ZWHCDLXHQMBZRD-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.11 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl N-methyl-N'-nitrocarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-methyl-N'-nitrocarbamimidate?
The IUPAC name of methyl N-methyl-N'-nitrocarbamimidate (CID 135581711) is methyl N-methyl-N'-nitrocarbamimidate.
What is the SMILES notation for methyl N-methyl-N'-nitrocarbamimidate?
The canonical SMILES for methyl N-methyl-N'-nitrocarbamimidate is CN/C(=N\[N+](=O)[O-])OC.
What is the InChIKey of methyl N-methyl-N'-nitrocarbamimidate?
The InChIKey is ZWHCDLXHQMBZRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N3O3/c1-4-3(9-2)5-6(7)8/h1-2H3,(H,4,5).
What are the key properties of methyl N-methyl-N'-nitrocarbamimidate?
methyl N-methyl-N'-nitrocarbamimidate has a molecular weight of 133.11 g/mol, XLogP of -0.60, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-methyl-N'-nitrocarbamimidate is sourced from PubChem (CID 135581711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).