About (1Z)-N-nitroethanimidate
(1Z)-N-nitroethanimidate (PubChem CID 22649980) has the molecular formula C2H3N2O3-
and a molecular weight of 103.06 g/mol. Its IUPAC name is (1Z)-N-nitroethanimidate.
Molecular Properties
| Compound Name | (1Z)-N-nitroethanimidate |
| PubChem CID | 22649980 |
| Molecular Formula | C2H3N2O3- |
| Molecular Weight | 103.06 g/mol |
| Exact Mass | 103.01 |
| IUPAC Name | (1Z)-N-nitroethanimidate |
| SMILES | C/C([O-])=N/[N+](=O)[O-] |
| InChI | InChI=1S/C2H4N2O3/c1-2(5)3-4(6)7/h1H3,(H,3,5)/p-1 |
| InChIKey | XVTVJNXKVZQUSM-UHFFFAOYSA-M |
| XLogP | -1.04 |
| TPSA | 78.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.06 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-N-nitroethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-N-nitroethanimidate?
The IUPAC name of (1Z)-N-nitroethanimidate (CID 22649980) is (1Z)-N-nitroethanimidate.
What is the SMILES notation for (1Z)-N-nitroethanimidate?
The canonical SMILES for (1Z)-N-nitroethanimidate is C/C([O-])=N/[N+](=O)[O-].
What is the InChIKey of (1Z)-N-nitroethanimidate?
The InChIKey is XVTVJNXKVZQUSM-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4N2O3/c1-2(5)3-4(6)7/h1H3,(H,3,5)/p-1.
What are the key properties of (1Z)-N-nitroethanimidate?
(1Z)-N-nitroethanimidate has a molecular weight of 103.06 g/mol, XLogP of -1.04, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-N-nitroethanimidate is sourced from PubChem (CID 22649980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).