C2HN5O9 — CID 137203255
N,2,2,2-tetranitroethanimidic acid (PubChem CID 137203255) has the molecular formula C2HN5O9 and a molecular weight of 239.06 g/mol. Its IUPAC name is N,2,2,2-tetranitroethanimidic acid.
| Compound Name | N,2,2,2-tetranitroethanimidic acid |
|---|---|
| PubChem CID | 137203255 |
| Molecular Formula | C2HN5O9 |
| Molecular Weight | 239.06 g/mol |
| Exact Mass | 238.98 |
| IUPAC Name | N,2,2,2-tetranitroethanimidic acid |
| SMILES | O=[N+]([O-])N=C(O)C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C2HN5O9/c8-1(3-7(15)16)2(4(9)10,5(11)12)6(13)14/h(H,3,8) |
| InChIKey | JSIFRTDCUYJVJY-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 205.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.06 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|