C2H4N10O8 — CID 137229387
N-[2-[[(E)-C,N-dinitrocarbonimidoyl]amino]hydrazinyl]-N',1-dinitro-N-oxido-N-oxomethanimidamide (PubChem CID 137229387) has the molecular formula C2H4N10O8 and a molecular weight of 296.12 g/mol. Its IUPAC name is N-[2-[[(E)-C,N-dinitrocarbonimidoyl]amino]hydrazinyl]-N',1-dinitro-N-oxido-N-oxomethanimidamide.
| Compound Name | N-[2-[[(E)-C,N-dinitrocarbonimidoyl]amino]hydrazinyl]-N',1-dinitro-N-oxido-N-oxomethanimidamide |
|---|---|
| PubChem CID | 137229387 |
| Molecular Formula | C2H4N10O8 |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | N-[2-[[(E)-C,N-dinitrocarbonimidoyl]amino]hydrazinyl]-N',1-dinitro-N-oxido-N-oxomethanimidamide |
| SMILES | O=[N+]([O-])/N=C(\NNNN/C(=N\[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C2H4N10O8/c13-9(14)1(5-11(17)18)3-7-8-4-2(10(15)16)6-12(19)20/h7-8H,(H,3,5)(H,4,6) |
| InChIKey | KBCOJNGTNQVOMP-UHFFFAOYSA-N |
| XLogP | -3.26 |
| TPSA | 245.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|