C6H12N18O6 — CID 139262767
1-[[4,6-bis[2-[(E)-N'-nitrocarbamimidoyl]hydrazinyl]-1,3,5-triazin-2-yl]amino]-2-nitroguanidine (PubChem CID 139262767) has the molecular formula C6H12N18O6 and a molecular weight of 432.28 g/mol. Its IUPAC name is 1-[[4,6-bis[2-[(E)-N'-nitrocarbamimidoyl]hydrazinyl]-1,3,5-triazin-2-yl]amino]-2-nitroguanidine.
| Compound Name | 1-[[4,6-bis[2-[(E)-N'-nitrocarbamimidoyl]hydrazinyl]-1,3,5-triazin-2-yl]amino]-2-nitroguanidine |
|---|---|
| PubChem CID | 139262767 |
| Molecular Formula | C6H12N18O6 |
| Molecular Weight | 432.28 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 1-[[4,6-bis[2-[(E)-N'-nitrocarbamimidoyl]hydrazinyl]-1,3,5-triazin-2-yl]amino]-2-nitroguanidine |
| SMILES | N/C(=N/[N+](=O)[O-])NNc1nc(NN/C(N)=N/[N+](=O)[O-])nc(NN/C(N)=N/[N+](=O)[O-])n1 |
| InChI | InChI=1S/C6H12N18O6/c7-1(19-22(25)26)13-16-4-10-5(17-14-2(8)20-23(27)28)12-6(11-4)18-15-3(9)21-24(29)30/h(H3,7,13,19)(H3,8,14,20)(H3,9,15,21)(H3,10,11,12,16,17,18) |
| InChIKey | FTWKVESGCBYWFT-UHFFFAOYSA-N |
| XLogP | -4.86 |
| TPSA | 355.41 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.28 |
| LogP ≤ 5 | -4.86 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|