C4H8N10O4 — CID 137225780
1-[(5-nitramido-1H-1,2,4-triazol-3-yl)methylamino]-2-nitroguanidine (PubChem CID 137225780) has the molecular formula C4H8N10O4 and a molecular weight of 260.17 g/mol. Its IUPAC name is 1-[(5-nitramido-1H-1,2,4-triazol-3-yl)methylamino]-2-nitroguanidine.
| Compound Name | 1-[(5-nitramido-1H-1,2,4-triazol-3-yl)methylamino]-2-nitroguanidine |
|---|---|
| PubChem CID | 137225780 |
| Molecular Formula | C4H8N10O4 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 1-[(5-nitramido-1H-1,2,4-triazol-3-yl)methylamino]-2-nitroguanidine |
| SMILES | NC(=N[N+](=O)[O-])NNCc1n[nH]c(N[N+](=O)[O-])n1 |
| InChI | InChI=1S/C4H8N10O4/c5-3(11-13(15)16)9-6-1-2-7-4(10-8-2)12-14(17)18/h6H,1H2,(H3,5,9,11)(H2,7,8,10,12) |
| InChIKey | KPUBCEPYZGXGAK-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 202.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|