C8H11N7O4 — CID 135468902
1-[[2-(3,5-dimethylpyrazol-1-yl)-2-oxoacetyl]amino]-2-nitroguanidine (PubChem CID 135468902) has the molecular formula C8H11N7O4 and a molecular weight of 269.22 g/mol. Its IUPAC name is 1-[[2-(3,5-dimethylpyrazol-1-yl)-2-oxoacetyl]amino]-2-nitroguanidine.
| Compound Name | 1-[[2-(3,5-dimethylpyrazol-1-yl)-2-oxoacetyl]amino]-2-nitroguanidine |
|---|---|
| PubChem CID | 135468902 |
| Molecular Formula | C8H11N7O4 |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 1-[[2-(3,5-dimethylpyrazol-1-yl)-2-oxoacetyl]amino]-2-nitroguanidine |
| SMILES | Cc1cc(C)n(C(=O)C(=O)NNC(N)=N[N+](=O)[O-])n1 |
| InChI | InChI=1S/C8H11N7O4/c1-4-3-5(2)14(12-4)7(17)6(16)10-11-8(9)13-15(18)19/h3H,1-2H3,(H,10,16)(H3,9,11,13) |
| InChIKey | FAIRWWCONAJRGH-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 157.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|