C5H9N5O — CID 165430146
(3,5-dimethylpyrazol-1-yl)-hydrazinylidene-oxidoazanium (PubChem CID 165430146) has the molecular formula C5H9N5O and a molecular weight of 155.16 g/mol. Its IUPAC name is (3,5-dimethylpyrazol-1-yl)-hydrazinylidene-oxidoazanium.
| Compound Name | (3,5-dimethylpyrazol-1-yl)-hydrazinylidene-oxidoazanium |
|---|---|
| PubChem CID | 165430146 |
| Molecular Formula | C5H9N5O |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | (3,5-dimethylpyrazol-1-yl)-hydrazinylidene-oxidoazanium |
| SMILES | Cc1cc(C)n([N+]([O-])=NN)n1 |
| InChI | InChI=1S/C5H9N5O/c1-4-3-5(2)9(7-4)10(11)8-6/h3H,6H2,1-2H3 |
| InChIKey | PCDQDHQNXYCAFG-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|