C7H11N3 — CID 18721438
1-(3,5-dimethylpyrazol-1-yl)-N-methylmethanimine (PubChem CID 18721438) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 1-(3,5-dimethylpyrazol-1-yl)-N-methylmethanimine.
| Compound Name | 1-(3,5-dimethylpyrazol-1-yl)-N-methylmethanimine |
|---|---|
| PubChem CID | 18721438 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 1-(3,5-dimethylpyrazol-1-yl)-N-methylmethanimine |
| SMILES | C/N=C/n1nc(C)cc1C |
| InChI | InChI=1S/C7H11N3/c1-6-4-7(2)10(9-6)5-8-3/h4-5H,1-3H3/b8-5+ |
| InChIKey | IQHOJELMHXIYIR-VMPITWQZSA-N |
| XLogP | 1.01 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|