C30H44B2N12Yb — CID 139133852
bis(tris(3,5-dimethylpyrazol-1-yl)boranuide);ytterbium(2+) (PubChem CID 139133852) has the molecular formula C30H44B2N12Yb and a molecular weight of 767.43 g/mol. Its IUPAC name is bis(tris(3,5-dimethylpyrazol-1-yl)boranuide);ytterbium(2+).
| Compound Name | bis(tris(3,5-dimethylpyrazol-1-yl)boranuide);ytterbium(2+) |
|---|---|
| PubChem CID | 139133852 |
| Molecular Formula | C30H44B2N12Yb |
| Molecular Weight | 767.43 g/mol |
| Exact Mass | 768.34 |
| IUPAC Name | bis(tris(3,5-dimethylpyrazol-1-yl)boranuide);ytterbium(2+) |
| SMILES | Cc1cc(C)n([BH-](n2nc(C)cc2C)n2nc(C)cc2C)n1.Cc1cc(C)n([BH-](n2nc(C)cc2C)n2nc(C)cc2C)n1.[Yb+2] |
| InChI | InChI=1S/2C15H22BN6.Yb/c2*1-10-7-13(4)20(17-10)16(21-14(5)8-11(2)18-21)22-15(6)9-12(3)19-22;/h2*7-9,16H,1-6H3;/q2*-1;+2 |
| InChIKey | XBRACNXISWNBDI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 106.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|