C15H26B2N6Ni — CID 139130888
boranuide;nickel(2+);tris(3,5-dimethylpyrazol-1-yl)boranuide (PubChem CID 139130888) has the molecular formula C15H26B2N6Ni and a molecular weight of 370.73 g/mol. Its IUPAC name is boranuide;nickel(2+);tris(3,5-dimethylpyrazol-1-yl)boranuide.
| Compound Name | boranuide;nickel(2+);tris(3,5-dimethylpyrazol-1-yl)boranuide |
|---|---|
| PubChem CID | 139130888 |
| Molecular Formula | C15H26B2N6Ni |
| Molecular Weight | 370.73 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | boranuide;nickel(2+);tris(3,5-dimethylpyrazol-1-yl)boranuide |
| SMILES | Cc1cc(C)n([BH-](n2nc(C)cc2C)n2nc(C)cc2C)n1.[BH4-].[Ni+2] |
| InChI | InChI=1S/C15H22BN6.BH4.Ni/c1-10-7-13(4)20(17-10)16(21-14(5)8-11(2)18-21)22-15(6)9-12(3)19-22;;/h7-9,16H,1-6H3;1H4;/q2*-1;+2 |
| InChIKey | GDCBZWUTEQMNIC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.73 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|