C7H12N2O — CID 70567807
1-(3,5-dimethylpyrazol-1-yl)ethanol (PubChem CID 70567807) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 1-(3,5-dimethylpyrazol-1-yl)ethanol.
| Compound Name | 1-(3,5-dimethylpyrazol-1-yl)ethanol |
|---|---|
| PubChem CID | 70567807 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 1-(3,5-dimethylpyrazol-1-yl)ethanol |
| SMILES | Cc1cc(C)n(C(C)O)n1 |
| InChI | InChI=1S/C7H12N2O/c1-5-4-6(2)9(8-5)7(3)10/h4,7,10H,1-3H3 |
| InChIKey | LIGRELKPKAHKGZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |