C9H15N3S — CID 60915402
3-(3,5-dimethylpyrazol-1-yl)butanethioamide (PubChem CID 60915402) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 3-(3,5-dimethylpyrazol-1-yl)butanethioamide.
| Compound Name | 3-(3,5-dimethylpyrazol-1-yl)butanethioamide |
|---|---|
| PubChem CID | 60915402 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 3-(3,5-dimethylpyrazol-1-yl)butanethioamide |
| SMILES | Cc1cc(C)n(C(C)CC(N)=S)n1 |
| InChI | InChI=1S/C9H15N3S/c1-6-4-7(2)12(11-6)8(3)5-9(10)13/h4,8H,5H2,1-3H3,(H2,10,13) |
| InChIKey | MHRHZRJAEGFPMG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|