C7H11BrN2 — CID 86146803
1-(1-bromoethyl)-3,5-dimethylpyrazole (PubChem CID 86146803) has the molecular formula C7H11BrN2 and a molecular weight of 203.08 g/mol. Its IUPAC name is 1-(1-bromoethyl)-3,5-dimethylpyrazole.
| Compound Name | 1-(1-bromoethyl)-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 86146803 |
| Molecular Formula | C7H11BrN2 |
| Molecular Weight | 203.08 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 1-(1-bromoethyl)-3,5-dimethylpyrazole |
| SMILES | Cc1cc(C)n(C(C)Br)n1 |
| InChI | InChI=1S/C7H11BrN2/c1-5-4-6(2)10(9-5)7(3)8/h4,7H,1-3H3 |
| InChIKey | ULYUTWLWENECSL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.08 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|