C12H16N4OS — CID 101366355
2,2-bis(3,5-dimethylpyrazol-1-yl)ethanethioic S-acid (PubChem CID 101366355) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is 2,2-bis(3,5-dimethylpyrazol-1-yl)ethanethioic S-acid.
| Compound Name | 2,2-bis(3,5-dimethylpyrazol-1-yl)ethanethioic S-acid |
|---|---|
| PubChem CID | 101366355 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2,2-bis(3,5-dimethylpyrazol-1-yl)ethanethioic S-acid |
| SMILES | Cc1cc(C)n(C(C(=O)S)n2nc(C)cc2C)n1 |
| InChI | InChI=1S/C12H16N4OS/c1-7-5-9(3)15(13-7)11(12(17)18)16-10(4)6-8(2)14-16/h5-6,11H,1-4H3,(H,17,18) |
| InChIKey | BEYNVEZPIOCKNI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 52.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|