C30H32Cl2N4O2PRu+ — CID 6394205
2,2-bis(3,5-dimethylpyrazol-1-yl)acetic acid;dichlororuthenium;triphenylphosphanium (PubChem CID 6394205) has the molecular formula C30H32Cl2N4O2PRu+ and a molecular weight of 683.56 g/mol. Its IUPAC name is 2,2-bis(3,5-dimethylpyrazol-1-yl)acetic acid;dichlororuthenium;triphenylphosphanium.
| Compound Name | 2,2-bis(3,5-dimethylpyrazol-1-yl)acetic acid;dichlororuthenium;triphenylphosphanium |
|---|---|
| PubChem CID | 6394205 |
| Molecular Formula | C30H32Cl2N4O2PRu+ |
| Molecular Weight | 683.56 g/mol |
| Exact Mass | 683.07 |
| IUPAC Name | 2,2-bis(3,5-dimethylpyrazol-1-yl)acetic acid;dichlororuthenium;triphenylphosphanium |
| SMILES | Cc1cc(C)n(C(C(=O)O)n2nc(C)cc2C)n1.Cl[Ru]Cl.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C12H16N4O2.2ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-5-9(3)15(13-7)11(12(17)18)16-10(4)6-8(2)14-16;;;/h1-15H;5-6,11H,1-4H3,(H,17,18);2*1H;/q;;;;+2/p-1 |
| InChIKey | ZWGKSWPJIURAKC-UHFFFAOYSA-M |
| XLogP | 6.00 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.56 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|