About 3,5-dimethylpyrazol-1-amine;europium
3,5-dimethylpyrazol-1-amine;europium (PubChem CID 159380818) has the molecular formula C5H9EuN3
and a molecular weight of 263.11 g/mol. Its IUPAC name is 3,5-dimethylpyrazol-1-amine;europium.
Molecular Properties
| Compound Name | 3,5-dimethylpyrazol-1-amine;europium |
| PubChem CID | 159380818 |
| Molecular Formula | C5H9EuN3 |
| Molecular Weight | 263.11 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 3,5-dimethylpyrazol-1-amine;europium |
| SMILES | Cc1cc(C)n(N)n1.[Eu] |
| InChI | InChI=1S/C5H9N3.Eu/c1-4-3-5(2)8(6)7-4;/h3H,6H2,1-2H3; |
| InChIKey | LKWOOIMFBXOEQE-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.11 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dimethylpyrazol-1-amine;europium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethylpyrazol-1-amine;europium?
The IUPAC name of 3,5-dimethylpyrazol-1-amine;europium (CID 159380818) is 3,5-dimethylpyrazol-1-amine;europium.
What is the SMILES notation for 3,5-dimethylpyrazol-1-amine;europium?
The canonical SMILES for 3,5-dimethylpyrazol-1-amine;europium is Cc1cc(C)n(N)n1.[Eu].
What is the InChIKey of 3,5-dimethylpyrazol-1-amine;europium?
The InChIKey is LKWOOIMFBXOEQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3.Eu/c1-4-3-5(2)8(6)7-4;/h3H,6H2,1-2H3;.
What are the key properties of 3,5-dimethylpyrazol-1-amine;europium?
3,5-dimethylpyrazol-1-amine;europium has a molecular weight of 263.11 g/mol, XLogP of 0.21, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethylpyrazol-1-amine;europium is sourced from PubChem (CID 159380818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).