C6H11N5 — CID 6453090
2-(3,5-dimethylpyrazol-1-yl)guanidine (PubChem CID 6453090) has the molecular formula C6H11N5 and a molecular weight of 153.19 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)guanidine.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)guanidine |
|---|---|
| PubChem CID | 6453090 |
| Molecular Formula | C6H11N5 |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)guanidine |
| SMILES | Cc1cc(C)n(N=C(N)N)n1 |
| InChI | InChI=1S/C6H11N5/c1-4-3-5(2)11(9-4)10-6(7)8/h3H,1-2H3,(H4,7,8,10) |
| InChIKey | ATRCEYNJCBJGAZ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|