C9H16N6 — CID 145003152
N'-[(Z)-1-aminopropylideneamino]-3,5-dimethylpyrazole-1-carboximidamide (PubChem CID 145003152) has the molecular formula C9H16N6 and a molecular weight of 208.27 g/mol. Its IUPAC name is N'-[(Z)-1-aminopropylideneamino]-3,5-dimethylpyrazole-1-carboximidamide.
| Compound Name | N'-[(Z)-1-aminopropylideneamino]-3,5-dimethylpyrazole-1-carboximidamide |
|---|---|
| PubChem CID | 145003152 |
| Molecular Formula | C9H16N6 |
| Molecular Weight | 208.27 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | N'-[(Z)-1-aminopropylideneamino]-3,5-dimethylpyrazole-1-carboximidamide |
| SMILES | CC/C(N)=N/N=C(\N)n1nc(C)cc1C |
| InChI | InChI=1S/C9H16N6/c1-4-8(10)12-13-9(11)15-7(3)5-6(2)14-15/h5H,4H2,1-3H3,(H2,10,12)(H2,11,13) |
| InChIKey | SJSLGPUCQGOFLM-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|