C15H25N5O2S — CID 158134564
tert-butyl 4-[[amino-(3,5-dimethylpyrazol-1-yl)methylidene]carbamothioylamino]butanoate (PubChem CID 158134564) has the molecular formula C15H25N5O2S and a molecular weight of 339.47 g/mol. Its IUPAC name is tert-butyl 4-[[amino-(3,5-dimethylpyrazol-1-yl)methylidene]carbamothioylamino]butanoate.
| Compound Name | tert-butyl 4-[[amino-(3,5-dimethylpyrazol-1-yl)methylidene]carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 158134564 |
| Molecular Formula | C15H25N5O2S |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | tert-butyl 4-[[amino-(3,5-dimethylpyrazol-1-yl)methylidene]carbamothioylamino]butanoate |
| SMILES | Cc1cc(C)n(C(N)=NC(=S)NCCCC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C15H25N5O2S/c1-10-9-11(2)20(19-10)13(16)18-14(23)17-8-6-7-12(21)22-15(3,4)5/h9H,6-8H2,1-5H3,(H3,16,17,18,23) |
| InChIKey | FTEPGMZJYJLLEZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|